C25H38N8O6S — CID 149054010
2-[[1-[2-[2-(4-butyltriazol-1-yl)ethoxy]ethyl]triazol-4-yl]methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide (PubChem CID 149054010) has the molecular formula C25H38N8O6S and a molecular weight of 578.70 g/mol. Its IUPAC name is 2-[[1-[2-[2-(4-butyltriazol-1-yl)ethoxy]ethyl]triazol-4-yl]methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[[1-[2-[2-(4-butyltriazol-1-yl)ethoxy]ethyl]triazol-4-yl]methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 149054010 |
| Molecular Formula | C25H38N8O6S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 2-[[1-[2-[2-(4-butyltriazol-1-yl)ethoxy]ethyl]triazol-4-yl]methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxy-3-methylbutanamide |
| SMILES | CCCCc1cn(CCOCCn2cc(CN(C(C(=O)NO)C(C)C)S(=O)(=O)c3ccc(OC)cc3)nn2)nn1 |
| InChI | InChI=1S/C25H38N8O6S/c1-5-6-7-20-16-31(29-26-20)12-14-39-15-13-32-17-21(27-30-32)18-33(24(19(2)3)25(34)28-35)40(36,37)23-10-8-22(38-4)9-11-23/h8-11,16-17,19,24,35H,5-7,12-15,18H2,1-4H3,(H,28,34) |
| InChIKey | QKJIBXYENPPJAW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 166.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|