C19H27F2N5O5S — CID 102341132
(2R)-2-[[4-(2-fluoroethoxy)phenyl]sulfonyl-[2-[1-(2-fluoroethyl)triazol-4-yl]ethyl]amino]-N-hydroxy-3-methylbutanamide (PubChem CID 102341132) has the molecular formula C19H27F2N5O5S and a molecular weight of 475.52 g/mol. Its IUPAC name is (2R)-2-[[4-(2-fluoroethoxy)phenyl]sulfonyl-[2-[1-(2-fluoroethyl)triazol-4-yl]ethyl]amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2R)-2-[[4-(2-fluoroethoxy)phenyl]sulfonyl-[2-[1-(2-fluoroethyl)triazol-4-yl]ethyl]amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 102341132 |
| Molecular Formula | C19H27F2N5O5S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2R)-2-[[4-(2-fluoroethoxy)phenyl]sulfonyl-[2-[1-(2-fluoroethyl)triazol-4-yl]ethyl]amino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@H](C(=O)NO)N(CCc1cn(CCF)nn1)S(=O)(=O)c1ccc(OCCF)cc1 |
| InChI | InChI=1S/C19H27F2N5O5S/c1-14(2)18(19(27)23-28)26(10-7-15-13-25(11-8-20)24-22-15)32(29,30)17-5-3-16(4-6-17)31-12-9-21/h3-6,13-14,18,28H,7-12H2,1-2H3,(H,23,27)/t18-/m1/s1 |
| InChIKey | UMKRPTUSMKLLMQ-GOSISDBHSA-N |
| XLogP | 1.36 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|