C24H37N5O4S — CID 178093617
4-[butylsulfanyl(methyl)amino]-N-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methyl]benzamide (PubChem CID 178093617) has the molecular formula C24H37N5O4S and a molecular weight of 491.66 g/mol. Its IUPAC name is 4-[butylsulfanyl(methyl)amino]-N-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methyl]benzamide.
| Compound Name | 4-[butylsulfanyl(methyl)amino]-N-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 178093617 |
| Molecular Formula | C24H37N5O4S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 4-[butylsulfanyl(methyl)amino]-N-[[1-[2-[2-(3-methyl-2-oxobutoxy)ethoxy]ethyl]triazol-4-yl]methyl]benzamide |
| SMILES | CCCCSN(C)c1ccc(C(=O)NCc2cn(CCOCCOCC(=O)C(C)C)nn2)cc1 |
| InChI | InChI=1S/C24H37N5O4S/c1-5-6-15-34-28(4)22-9-7-20(8-10-22)24(31)25-16-21-17-29(27-26-21)11-12-32-13-14-33-18-23(30)19(2)3/h7-10,17,19H,5-6,11-16,18H2,1-4H3,(H,25,31) |
| InChIKey | PBPXBWBEJGTTJX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|