C18H32N4O5 — CID 162217817
(1-butyltriazol-4-yl)methyl 5-[2-(2-methoxyethoxy)ethylamino]-4-methyl-5-oxopentanoate (PubChem CID 162217817) has the molecular formula C18H32N4O5 and a molecular weight of 384.48 g/mol. Its IUPAC name is (1-butyltriazol-4-yl)methyl 5-[2-(2-methoxyethoxy)ethylamino]-4-methyl-5-oxopentanoate.
| Compound Name | (1-butyltriazol-4-yl)methyl 5-[2-(2-methoxyethoxy)ethylamino]-4-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 162217817 |
| Molecular Formula | C18H32N4O5 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (1-butyltriazol-4-yl)methyl 5-[2-(2-methoxyethoxy)ethylamino]-4-methyl-5-oxopentanoate |
| SMILES | CCCCn1cc(COC(=O)CCC(C)C(=O)NCCOCCOC)nn1 |
| InChI | InChI=1S/C18H32N4O5/c1-4-5-9-22-13-16(20-21-22)14-27-17(23)7-6-15(2)18(24)19-8-10-26-12-11-25-3/h13,15H,4-12,14H2,1-3H3,(H,19,24) |
| InChIKey | YFKUWZKYTAJOCT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|