C14H26N4O2 — CID 178007494
3-[4-(4-methyl-3-oxopentyl)triazol-1-yl]-N-propylpropanamide;molecular hydrogen (PubChem CID 178007494) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[4-(4-methyl-3-oxopentyl)triazol-1-yl]-N-propylpropanamide;molecular hydrogen.
| Compound Name | 3-[4-(4-methyl-3-oxopentyl)triazol-1-yl]-N-propylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 178007494 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-[4-(4-methyl-3-oxopentyl)triazol-1-yl]-N-propylpropanamide;molecular hydrogen |
| SMILES | CCCNC(=O)CCn1cc(CCC(=O)C(C)C)nn1.[H][H] |
| InChI | InChI=1S/C14H24N4O2.H2/c1-4-8-15-14(20)7-9-18-10-12(16-17-18)5-6-13(19)11(2)3;/h10-11H,4-9H2,1-3H3,(H,15,20);1H |
| InChIKey | FVLUEADNSJOZNS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |