C19H39N5O2 — CID 171554916
ethane;4-(methylamino)-N-[[1-(4-methylpentyl)triazol-4-yl]methyl]butanamide;propanal (PubChem CID 171554916) has the molecular formula C19H39N5O2 and a molecular weight of 369.55 g/mol. Its IUPAC name is ethane;4-(methylamino)-N-[[1-(4-methylpentyl)triazol-4-yl]methyl]butanamide;propanal.
| Compound Name | ethane;4-(methylamino)-N-[[1-(4-methylpentyl)triazol-4-yl]methyl]butanamide;propanal |
|---|---|
| PubChem CID | 171554916 |
| Molecular Formula | C19H39N5O2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | ethane;4-(methylamino)-N-[[1-(4-methylpentyl)triazol-4-yl]methyl]butanamide;propanal |
| SMILES | CC.CCC=O.CNCCCC(=O)NCc1cn(CCCC(C)C)nn1 |
| InChI | InChI=1S/C14H27N5O.C3H6O.C2H6/c1-12(2)6-5-9-19-11-13(17-18-19)10-16-14(20)7-4-8-15-3;1-2-3-4;1-2/h11-12,15H,4-10H2,1-3H3,(H,16,20);3H,2H2,1H3;1-2H3 |
| InChIKey | RVZBCXLJUUAVDY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|