C15H33N7O — CID 176576322
ethane;N-[2-(methylamino)ethyl]-2-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethylamino]acetamide (PubChem CID 176576322) has the molecular formula C15H33N7O and a molecular weight of 327.48 g/mol. Its IUPAC name is ethane;N-[2-(methylamino)ethyl]-2-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethylamino]acetamide.
| Compound Name | ethane;N-[2-(methylamino)ethyl]-2-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethylamino]acetamide |
|---|---|
| PubChem CID | 176576322 |
| Molecular Formula | C15H33N7O |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | ethane;N-[2-(methylamino)ethyl]-2-[2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]ethylamino]acetamide |
| SMILES | CC.CNCCNC(=O)CNCCn1cc(CNC(C)C)nn1 |
| InChI | InChI=1S/C13H27N7O.C2H6/c1-11(2)17-8-12-10-20(19-18-12)7-6-15-9-13(21)16-5-4-14-3;1-2/h10-11,14-15,17H,4-9H2,1-3H3,(H,16,21);1-2H3 |
| InChIKey | KZJOHFGVLFDRHP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|