C10H18N6O2 — CID 66194155
N'-acetyl-2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]acetohydrazide (PubChem CID 66194155) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is N'-acetyl-2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]acetohydrazide.
| Compound Name | N'-acetyl-2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 66194155 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N'-acetyl-2-[4-[(propan-2-ylamino)methyl]triazol-1-yl]acetohydrazide |
| SMILES | CC(=O)NNC(=O)Cn1cc(CNC(C)C)nn1 |
| InChI | InChI=1S/C10H18N6O2/c1-7(2)11-4-9-5-16(15-13-9)6-10(18)14-12-8(3)17/h5,7,11H,4,6H2,1-3H3,(H,12,17)(H,14,18) |
| InChIKey | BLRRIIWYYUJUCY-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|