C17H29N5O3 — CID 176953322
N-[[1-[3-(2-methylbutylamino)-3-oxopropyl]triazol-4-yl]methyl]-4-oxohexanamide (PubChem CID 176953322) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[[1-[3-(2-methylbutylamino)-3-oxopropyl]triazol-4-yl]methyl]-4-oxohexanamide.
| Compound Name | N-[[1-[3-(2-methylbutylamino)-3-oxopropyl]triazol-4-yl]methyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 176953322 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[[1-[3-(2-methylbutylamino)-3-oxopropyl]triazol-4-yl]methyl]-4-oxohexanamide |
| SMILES | CCC(=O)CCC(=O)NCc1cn(CCC(=O)NCC(C)CC)nn1 |
| InChI | InChI=1S/C17H29N5O3/c1-4-13(3)10-18-17(25)8-9-22-12-14(20-21-22)11-19-16(24)7-6-15(23)5-2/h12-13H,4-11H2,1-3H3,(H,18,25)(H,19,24) |
| InChIKey | JDJSPGHGULRMFI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |