C11H16F3N3O4 — CID 104566929
2,2,2-trifluoro-1-[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethanone (PubChem CID 104566929) has the molecular formula C11H16F3N3O4 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethanone |
|---|---|
| PubChem CID | 104566929 |
| Molecular Formula | C11H16F3N3O4 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]triazol-4-yl]ethanone |
| SMILES | COCCOCCOCCn1cc(C(=O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C11H16F3N3O4/c1-19-4-5-21-7-6-20-3-2-17-8-9(15-16-17)10(18)11(12,13)14/h8H,2-7H2,1H3 |
| InChIKey | FUUJFBPHPRSCLK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|