C14H27N3 — CID 157335389
1-(6,6-dimethylheptyl)-4-propyltriazole (PubChem CID 157335389) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-(6,6-dimethylheptyl)-4-propyltriazole.
| Compound Name | 1-(6,6-dimethylheptyl)-4-propyltriazole |
|---|---|
| PubChem CID | 157335389 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 1-(6,6-dimethylheptyl)-4-propyltriazole |
| SMILES | CCCc1cn(CCCCCC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H27N3/c1-5-9-13-12-17(16-15-13)11-8-6-7-10-14(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | TWELRMMSRGIGFR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|