C11H16N8O2 — CID 145496803
N-[[1-[3-[4-(formamidomethyl)triazol-1-yl]propyl]triazol-4-yl]methyl]formamide (PubChem CID 145496803) has the molecular formula C11H16N8O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is N-[[1-[3-[4-(formamidomethyl)triazol-1-yl]propyl]triazol-4-yl]methyl]formamide.
| Compound Name | N-[[1-[3-[4-(formamidomethyl)triazol-1-yl]propyl]triazol-4-yl]methyl]formamide |
|---|---|
| PubChem CID | 145496803 |
| Molecular Formula | C11H16N8O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[[1-[3-[4-(formamidomethyl)triazol-1-yl]propyl]triazol-4-yl]methyl]formamide |
| SMILES | O=CNCc1cn(CCCn2cc(CNC=O)nn2)nn1 |
| InChI | InChI=1S/C11H16N8O2/c20-8-12-4-10-6-18(16-14-10)2-1-3-19-7-11(15-17-19)5-13-9-21/h6-9H,1-5H2,(H,12,20)(H,13,21) |
| InChIKey | VWBDTPOATRLKKI-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|