C19H30N4O4 — CID 178007512
2-methylpropyl 3-[4-[4-[[(E)-4-oxohex-2-enoyl]amino]butyl]triazol-1-yl]propanoate (PubChem CID 178007512) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-methylpropyl 3-[4-[4-[[(E)-4-oxohex-2-enoyl]amino]butyl]triazol-1-yl]propanoate.
| Compound Name | 2-methylpropyl 3-[4-[4-[[(E)-4-oxohex-2-enoyl]amino]butyl]triazol-1-yl]propanoate |
|---|---|
| PubChem CID | 178007512 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-methylpropyl 3-[4-[4-[[(E)-4-oxohex-2-enoyl]amino]butyl]triazol-1-yl]propanoate |
| SMILES | CCC(=O)/C=C/C(=O)NCCCCc1cn(CCC(=O)OCC(C)C)nn1 |
| InChI | InChI=1S/C19H30N4O4/c1-4-17(24)8-9-18(25)20-11-6-5-7-16-13-23(22-21-16)12-10-19(26)27-14-15(2)3/h8-9,13,15H,4-7,10-12,14H2,1-3H3,(H,20,25)/b9-8+ |
| InChIKey | OXOOIISLURYNKF-CMDGGOBGSA-N |
| XLogP | 1.84 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|