C18H31N5O — CID 145272282
N-[3-[4-[5-[methyl(propyl)amino]hex-5-enyl]triazol-1-yl]propyl]prop-2-enamide (PubChem CID 145272282) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N-[3-[4-[5-[methyl(propyl)amino]hex-5-enyl]triazol-1-yl]propyl]prop-2-enamide.
| Compound Name | N-[3-[4-[5-[methyl(propyl)amino]hex-5-enyl]triazol-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 145272282 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N-[3-[4-[5-[methyl(propyl)amino]hex-5-enyl]triazol-1-yl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCn1cc(CCCCC(=C)N(C)CCC)nn1 |
| InChI | InChI=1S/C18H31N5O/c1-5-13-22(4)16(3)10-7-8-11-17-15-23(21-20-17)14-9-12-19-18(24)6-2/h6,15H,2-3,5,7-14H2,1,4H3,(H,19,24) |
| InChIKey | DUBYCVRBQKATCG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|