C12H25N5O — CID 163400080
N-[2-[1-(3-aminopropyl)triazol-4-yl]ethyl]propanamide;ethane (PubChem CID 163400080) has the molecular formula C12H25N5O and a molecular weight of 255.37 g/mol. Its IUPAC name is N-[2-[1-(3-aminopropyl)triazol-4-yl]ethyl]propanamide;ethane.
| Compound Name | N-[2-[1-(3-aminopropyl)triazol-4-yl]ethyl]propanamide;ethane |
|---|---|
| PubChem CID | 163400080 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | N-[2-[1-(3-aminopropyl)triazol-4-yl]ethyl]propanamide;ethane |
| SMILES | CC.CCC(=O)NCCc1cn(CCCN)nn1 |
| InChI | InChI=1S/C10H19N5O.C2H6/c1-2-10(16)12-6-4-9-8-15(14-13-9)7-3-5-11;1-2/h8H,2-7,11H2,1H3,(H,12,16);1-2H3 |
| InChIKey | BAWMQSWNFIXJQF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |