C21H36N4O4 — CID 163756151
(E)-N-[4-[1-[2-(3-ethoxybutoxy)ethyl]triazol-4-yl]butyl]-5-methyl-4-oxohex-2-enamide (PubChem CID 163756151) has the molecular formula C21H36N4O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is (E)-N-[4-[1-[2-(3-ethoxybutoxy)ethyl]triazol-4-yl]butyl]-5-methyl-4-oxohex-2-enamide.
| Compound Name | (E)-N-[4-[1-[2-(3-ethoxybutoxy)ethyl]triazol-4-yl]butyl]-5-methyl-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 163756151 |
| Molecular Formula | C21H36N4O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (E)-N-[4-[1-[2-(3-ethoxybutoxy)ethyl]triazol-4-yl]butyl]-5-methyl-4-oxohex-2-enamide |
| SMILES | CCOC(C)CCOCCn1cc(CCCCNC(=O)/C=C/C(=O)C(C)C)nn1 |
| InChI | InChI=1S/C21H36N4O4/c1-5-29-18(4)11-14-28-15-13-25-16-19(23-24-25)8-6-7-12-22-21(27)10-9-20(26)17(2)3/h9-10,16-18H,5-8,11-15H2,1-4H3,(H,22,27)/b10-9+ |
| InChIKey | LUFRPLMKCOMBAA-MDZDMXLPSA-N |
| XLogP | 2.33 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|