C26H46N4O10 — CID 158343037
N-[2-[[1-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]pentanamide (PubChem CID 158343037) has the molecular formula C26H46N4O10 and a molecular weight of 574.67 g/mol. Its IUPAC name is N-[2-[[1-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]pentanamide.
| Compound Name | N-[2-[[1-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 158343037 |
| Molecular Formula | C26H46N4O10 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | N-[2-[[1-[2-[2-[2-[2-[[(1S,2R,3R,4R,5S)-2,3-dihydroxy-4-methyl-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]ethoxy]ethoxy]ethoxy]ethyl]triazol-4-yl]methoxy]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCOCc1cn(CCOCCOCCOCCOC[C@@]23CO[C@@H](O2)[C@H](C)[C@@H](O)[C@H]3O)nn1 |
| InChI | InChI=1S/C26H46N4O10/c1-3-4-5-22(31)27-6-8-37-17-21-16-30(29-28-21)7-9-34-10-11-35-12-13-36-14-15-38-18-26-19-39-25(40-26)20(2)23(32)24(26)33/h16,20,23-25,32-33H,3-15,17-19H2,1-2H3,(H,27,31)/t20-,23-,24-,25+,26+/m1/s1 |
| InChIKey | RHHPUYDJOHBFRF-SWOLCGDXSA-N |
| XLogP | -0.35 |
| TPSA | 164.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|