C23H40N6O4S — CID 137390160
5-[(3aS,4S,6aR)-3a,6a-dimethyl-2-oxo-1,3,4,6-tetrahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(4-propyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 137390160) has the molecular formula C23H40N6O4S and a molecular weight of 496.68 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-3a,6a-dimethyl-2-oxo-1,3,4,6-tetrahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(4-propyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-3a,6a-dimethyl-2-oxo-1,3,4,6-tetrahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(4-propyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 137390160 |
| Molecular Formula | C23H40N6O4S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | 5-[(3aS,4S,6aR)-3a,6a-dimethyl-2-oxo-1,3,4,6-tetrahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-(4-propyltriazol-1-yl)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | CCCc1cn(CCOCCOCCNC(=O)CCCC[C@@H]2SC[C@]3(C)NC(=O)N[C@]23C)nn1 |
| InChI | InChI=1S/C23H40N6O4S/c1-4-7-18-16-29(28-27-18)11-13-33-15-14-32-12-10-24-20(30)9-6-5-8-19-23(3)22(2,17-34-19)25-21(31)26-23/h16,19H,4-15,17H2,1-3H3,(H,24,30)(H2,25,26,31)/t19-,22-,23+/m0/s1 |
| InChIKey | PHYXUYZEKGNGGV-AJSBUHFISA-N |
| XLogP | 1.89 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|