C7H12N6O2 — CID 62053982
3-[4-(aminomethyl)triazol-1-yl]-N-carbamoylpropanamide (PubChem CID 62053982) has the molecular formula C7H12N6O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-[4-(aminomethyl)triazol-1-yl]-N-carbamoylpropanamide.
| Compound Name | 3-[4-(aminomethyl)triazol-1-yl]-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 62053982 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-[4-(aminomethyl)triazol-1-yl]-N-carbamoylpropanamide |
| SMILES | NCc1cn(CCC(=O)NC(N)=O)nn1 |
| InChI | InChI=1S/C7H12N6O2/c8-3-5-4-13(12-11-5)2-1-6(14)10-7(9)15/h4H,1-3,8H2,(H3,9,10,14,15) |
| InChIKey | MTSMSXIGNSBRRE-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |