C6H12N5OP — CID 166768800
N-[2-[4-(aminomethyl)triazol-1-yl]ethyl]-1-phosphanylformamide (PubChem CID 166768800) has the molecular formula C6H12N5OP and a molecular weight of 201.17 g/mol. Its IUPAC name is N-[2-[4-(aminomethyl)triazol-1-yl]ethyl]-1-phosphanylformamide.
| Compound Name | N-[2-[4-(aminomethyl)triazol-1-yl]ethyl]-1-phosphanylformamide |
|---|---|
| PubChem CID | 166768800 |
| Molecular Formula | C6H12N5OP |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | N-[2-[4-(aminomethyl)triazol-1-yl]ethyl]-1-phosphanylformamide |
| SMILES | NCc1cn(CCNC(=O)P)nn1 |
| InChI | InChI=1S/C6H12N5OP/c7-3-5-4-11(10-9-5)2-1-8-6(12)13/h4H,1-3,7,13H2,(H,8,12) |
| InChIKey | IJDZDIWTPQYAQM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|