C6H13N5 — CID 115460281
2-[4-(aminomethyl)triazol-1-yl]-N-methylethanamine (PubChem CID 115460281) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-[4-(aminomethyl)triazol-1-yl]-N-methylethanamine.
| Compound Name | 2-[4-(aminomethyl)triazol-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 115460281 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | 2-[4-(aminomethyl)triazol-1-yl]-N-methylethanamine |
| SMILES | CNCCn1cc(CN)nn1 |
| InChI | InChI=1S/C6H13N5/c1-8-2-3-11-5-6(4-7)9-10-11/h5,8H,2-4,7H2,1H3 |
| InChIKey | ZDWBHQFGKISIHE-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |