C34H74N6O4 — CID 155739514
ethane;N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]acetamide;N-[3-[4-[2-(propan-2-ylamino)ethyl]triazol-1-yl]propyl]formamide (PubChem CID 155739514) has the molecular formula C34H74N6O4 and a molecular weight of 631.00 g/mol. Its IUPAC name is ethane;N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]acetamide;N-[3-[4-[2-(propan-2-ylamino)ethyl]triazol-1-yl]propyl]formamide.
| Compound Name | ethane;N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]acetamide;N-[3-[4-[2-(propan-2-ylamino)ethyl]triazol-1-yl]propyl]formamide |
|---|---|
| PubChem CID | 155739514 |
| Molecular Formula | C34H74N6O4 |
| Molecular Weight | 631.00 g/mol |
| Exact Mass | 630.58 |
| IUPAC Name | ethane;N-[5-[2-(6-methylheptoxy)ethoxy]pentyl]acetamide;N-[3-[4-[2-(propan-2-ylamino)ethyl]triazol-1-yl]propyl]formamide |
| SMILES | CC.CC.CC.CC(=O)NCCCCCOCCOCCCCCC(C)C.CC(C)NCCc1cn(CCCNC=O)nn1 |
| InChI | InChI=1S/C17H35NO3.C11H21N5O.3C2H6/c1-16(2)10-6-4-8-12-20-14-15-21-13-9-5-7-11-18-17(3)19;1-10(2)13-6-4-11-8-16(15-14-11)7-3-5-12-9-17;3*1-2/h16H,4-15H2,1-3H3,(H,18,19);8-10,13H,3-7H2,1-2H3,(H,12,17);3*1-2H3 |
| InChIKey | INYRCJIARNHMNC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.00 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|