C12H23N5O — CID 66193355
N,N-dimethyl-4-[4-(propylaminomethyl)triazol-1-yl]butanamide (PubChem CID 66193355) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(propylaminomethyl)triazol-1-yl]butanamide.
| Compound Name | N,N-dimethyl-4-[4-(propylaminomethyl)triazol-1-yl]butanamide |
|---|---|
| PubChem CID | 66193355 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | N,N-dimethyl-4-[4-(propylaminomethyl)triazol-1-yl]butanamide |
| SMILES | CCCNCc1cn(CCCC(=O)N(C)C)nn1 |
| InChI | InChI=1S/C12H23N5O/c1-4-7-13-9-11-10-17(15-14-11)8-5-6-12(18)16(2)3/h10,13H,4-9H2,1-3H3 |
| InChIKey | FQKPHBWPKWLKBI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|