C9H14N4O2 — CID 66214983
4-(4-formyltriazol-1-yl)-N,N-dimethylbutanamide (PubChem CID 66214983) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-(4-formyltriazol-1-yl)-N,N-dimethylbutanamide.
| Compound Name | 4-(4-formyltriazol-1-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 66214983 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 4-(4-formyltriazol-1-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCn1cc(C=O)nn1 |
| InChI | InChI=1S/C9H14N4O2/c1-12(2)9(15)4-3-5-13-6-8(7-14)10-11-13/h6-7H,3-5H2,1-2H3 |
| InChIKey | GOHYBZGMADEUDQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|