C12H22N4O3 — CID 66216352
3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropanamide (PubChem CID 66216352) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropanamide.
| Compound Name | 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 66216352 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropanamide |
| SMILES | CCOC(OCC)c1cn(CCC(=O)N(C)C)nn1 |
| InChI | InChI=1S/C12H22N4O3/c1-5-18-12(19-6-2)10-9-16(14-13-10)8-7-11(17)15(3)4/h9,12H,5-8H2,1-4H3 |
| InChIKey | NZYMZHXFNFLAIM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|