C12H24N4O2 — CID 114526858
3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 114526858) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114526858 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3-[4-(diethoxymethyl)triazol-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CCOC(OCC)c1cn(CCCN(C)C)nn1 |
| InChI | InChI=1S/C12H24N4O2/c1-5-17-12(18-6-2)11-10-16(14-13-11)9-7-8-15(3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | ZLEHCTFBXOKSJE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|