C14H26N4O3 — CID 66216759
2-[4-(diethoxymethyl)triazol-1-yl]-N-pentan-2-ylacetamide (PubChem CID 66216759) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-[4-(diethoxymethyl)triazol-1-yl]-N-pentan-2-ylacetamide.
| Compound Name | 2-[4-(diethoxymethyl)triazol-1-yl]-N-pentan-2-ylacetamide |
|---|---|
| PubChem CID | 66216759 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 2-[4-(diethoxymethyl)triazol-1-yl]-N-pentan-2-ylacetamide |
| SMILES | CCCC(C)NC(=O)Cn1cc(C(OCC)OCC)nn1 |
| InChI | InChI=1S/C14H26N4O3/c1-5-8-11(4)15-13(19)10-18-9-12(16-17-18)14(20-6-2)21-7-3/h9,11,14H,5-8,10H2,1-4H3,(H,15,19) |
| InChIKey | LZIMQHLQZDLEDS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|