C34H67N7O2 — CID 164535699
ethane;3-methyl-N-[4-(4-propyltriazol-1-yl)butyl]butanamide;10-[4-(2-methylpropyl)triazol-1-yl]decan-3-one (PubChem CID 164535699) has the molecular formula C34H67N7O2 and a molecular weight of 605.96 g/mol. Its IUPAC name is ethane;3-methyl-N-[4-(4-propyltriazol-1-yl)butyl]butanamide;10-[4-(2-methylpropyl)triazol-1-yl]decan-3-one.
| Compound Name | ethane;3-methyl-N-[4-(4-propyltriazol-1-yl)butyl]butanamide;10-[4-(2-methylpropyl)triazol-1-yl]decan-3-one |
|---|---|
| PubChem CID | 164535699 |
| Molecular Formula | C34H67N7O2 |
| Molecular Weight | 605.96 g/mol |
| Exact Mass | 605.54 |
| IUPAC Name | ethane;3-methyl-N-[4-(4-propyltriazol-1-yl)butyl]butanamide;10-[4-(2-methylpropyl)triazol-1-yl]decan-3-one |
| SMILES | CC.CC.CCC(=O)CCCCCCCn1cc(CC(C)C)nn1.CCCc1cn(CCCCNC(=O)CC(C)C)nn1 |
| InChI | InChI=1S/C16H29N3O.C14H26N4O.2C2H6/c1-4-16(20)10-8-6-5-7-9-11-19-13-15(17-18-19)12-14(2)3;1-4-7-13-11-18(17-16-13)9-6-5-8-15-14(19)10-12(2)3;2*1-2/h13-14H,4-12H2,1-3H3;11-12H,4-10H2,1-3H3,(H,15,19);2*1-2H3 |
| InChIKey | NWMDLEZDWOCLMV-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.96 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|