C18H40N4O2S — CID 144515294
ethane;N-[2-[4-(methoxymethyl)triazol-1-yl]ethyl]-2-methylsulfanylacetamide;pentane (PubChem CID 144515294) has the molecular formula C18H40N4O2S and a molecular weight of 376.61 g/mol. Its IUPAC name is ethane;N-[2-[4-(methoxymethyl)triazol-1-yl]ethyl]-2-methylsulfanylacetamide;pentane.
| Compound Name | ethane;N-[2-[4-(methoxymethyl)triazol-1-yl]ethyl]-2-methylsulfanylacetamide;pentane |
|---|---|
| PubChem CID | 144515294 |
| Molecular Formula | C18H40N4O2S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | ethane;N-[2-[4-(methoxymethyl)triazol-1-yl]ethyl]-2-methylsulfanylacetamide;pentane |
| SMILES | CC.CC.CCCCC.COCc1cn(CCNC(=O)CSC)nn1 |
| InChI | InChI=1S/C9H16N4O2S.C5H12.2C2H6/c1-15-6-8-5-13(12-11-8)4-3-10-9(14)7-16-2;1-3-5-4-2;2*1-2/h5H,3-4,6-7H2,1-2H3,(H,10,14);3-5H2,1-2H3;2*1-2H3 |
| InChIKey | LFMDRAFPSLPMHS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |