C17H38N4O4 — CID 144977278
ethane;2-[2-[2-[2-[4-(methoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]-N-methylethanamine (PubChem CID 144977278) has the molecular formula C17H38N4O4 and a molecular weight of 362.52 g/mol. Its IUPAC name is ethane;2-[2-[2-[2-[4-(methoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]-N-methylethanamine.
| Compound Name | ethane;2-[2-[2-[2-[4-(methoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 144977278 |
| Molecular Formula | C17H38N4O4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.29 |
| IUPAC Name | ethane;2-[2-[2-[2-[4-(methoxymethyl)triazol-1-yl]ethoxy]ethoxy]ethoxy]-N-methylethanamine |
| SMILES | CC.CC.CNCCOCCOCCOCCn1cc(COC)nn1 |
| InChI | InChI=1S/C13H26N4O4.2C2H6/c1-14-3-5-19-7-9-21-10-8-20-6-4-17-11-13(12-18-2)15-16-17;2*1-2/h11,14H,3-10,12H2,1-2H3;2*1-2H3 |
| InChIKey | XRJFBAYUOWXFDR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|