C19H25F9N6O4 — CID 132582699
1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4-[[1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)triazol-4-yl]methoxymethyl]triazole (PubChem CID 132582699) has the molecular formula C19H25F9N6O4 and a molecular weight of 572.43 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4-[[1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)triazol-4-yl]methoxymethyl]triazole.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4-[[1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)triazol-4-yl]methoxymethyl]triazole |
|---|---|
| PubChem CID | 132582699 |
| Molecular Formula | C19H25F9N6O4 |
| Molecular Weight | 572.43 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-4-[[1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)triazol-4-yl]methoxymethyl]triazole |
| SMILES | COCCOCCOCCn1cc(COCc2cn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)nn2)nn1 |
| InChI | InChI=1S/C19H25F9N6O4/c1-35-6-7-37-9-8-36-5-4-34-11-15(30-32-34)13-38-12-14-10-33(31-29-14)3-2-16(20,21)17(22,23)18(24,25)19(26,27)28/h10-11H,2-9,12-13H2,1H3 |
| InChIKey | CNNZRYYSKJQZJF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|