C16H17N5O2S — CID 119055253
4-[4-(phenoxymethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 119055253) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-[4-(phenoxymethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-[4-(phenoxymethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 119055253 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-[4-(phenoxymethyl)triazol-1-yl]-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCn1cc(COc2ccccc2)nn1)Nc1nccs1 |
| InChI | InChI=1S/C16H17N5O2S/c22-15(18-16-17-8-10-24-16)7-4-9-21-11-13(19-20-21)12-23-14-5-2-1-3-6-14/h1-3,5-6,8,10-11H,4,7,9,12H2,(H,17,18,22) |
| InChIKey | HFTXWHZLBUHVGR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |