C25H24BrF17O3 — CID 100922458
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-bromo-4-octoxybenzoate (PubChem CID 100922458) has the molecular formula C25H24BrF17O3 and a molecular weight of 775.33 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-bromo-4-octoxybenzoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-bromo-4-octoxybenzoate |
|---|---|
| PubChem CID | 100922458 |
| Molecular Formula | C25H24BrF17O3 |
| Molecular Weight | 775.33 g/mol |
| Exact Mass | 774.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 3-bromo-4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C25H24BrF17O3/c1-2-3-4-5-6-7-11-45-16-9-8-14(13-15(16)26)17(44)46-12-10-18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)25(41,42)43/h8-9,13H,2-7,10-12H2,1H3 |
| InChIKey | XKBHYMYLFDFCDU-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.33 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|