C29H24BrF17N2O3 — CID 101042766
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-[[4-(6-bromohexoxy)phenyl]diazenyl]benzoate (PubChem CID 101042766) has the molecular formula C29H24BrF17N2O3 and a molecular weight of 851.39 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-[[4-(6-bromohexoxy)phenyl]diazenyl]benzoate.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-[[4-(6-bromohexoxy)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 101042766 |
| Molecular Formula | C29H24BrF17N2O3 |
| Molecular Weight | 851.39 g/mol |
| Exact Mass | 850.07 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl 4-[[4-(6-bromohexoxy)phenyl]diazenyl]benzoate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(/N=N/c2ccc(OCCCCCCBr)cc2)cc1 |
| InChI | InChI=1S/C29H24BrF17N2O3/c30-14-3-1-2-4-15-51-20-11-9-19(10-12-20)49-48-18-7-5-17(6-8-18)21(50)52-16-13-22(31,32)23(33,34)24(35,36)25(37,38)26(39,40)27(41,42)28(43,44)29(45,46)47/h5-12H,1-4,13-16H2/b49-48+ |
| InChIKey | SJEDGZJRKNKCPH-DSIMXMMZSA-N |
| XLogP | 11.99 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.39 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|