C20H22BrF3N2O2 — CID 102427562
[4-(6-bromohexoxy)phenyl]-[4-(2,2,2-trifluoroethoxy)phenyl]diazene (PubChem CID 102427562) has the molecular formula C20H22BrF3N2O2 and a molecular weight of 459.31 g/mol. Its IUPAC name is [4-(6-bromohexoxy)phenyl]-[4-(2,2,2-trifluoroethoxy)phenyl]diazene.
| Compound Name | [4-(6-bromohexoxy)phenyl]-[4-(2,2,2-trifluoroethoxy)phenyl]diazene |
|---|---|
| PubChem CID | 102427562 |
| Molecular Formula | C20H22BrF3N2O2 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | [4-(6-bromohexoxy)phenyl]-[4-(2,2,2-trifluoroethoxy)phenyl]diazene |
| SMILES | FC(F)(F)COc1ccc(/N=N/c2ccc(OCCCCCCBr)cc2)cc1 |
| InChI | InChI=1S/C20H22BrF3N2O2/c21-13-3-1-2-4-14-27-18-9-5-16(6-10-18)25-26-17-7-11-19(12-8-17)28-15-20(22,23)24/h5-12H,1-4,13-15H2/b26-25+ |
| InChIKey | LZKDPEYAXAVGEF-OCEACIFDSA-N |
| XLogP | 7.38 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|