C27H22F26O3 — CID 16744183
[3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methanol (PubChem CID 16744183) has the molecular formula C27H22F26O3 and a molecular weight of 888.42 g/mol. Its IUPAC name is [3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methanol.
| Compound Name | [3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methanol |
|---|---|
| PubChem CID | 16744183 |
| Molecular Formula | C27H22F26O3 |
| Molecular Weight | 888.42 g/mol |
| Exact Mass | 888.12 |
| IUPAC Name | [3,5-bis(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluorodecoxy)phenyl]methanol |
| SMILES | OCc1cc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(OCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F26O3/c28-16(29,18(32,33)20(36,37)22(40,41)24(44,45)26(48,49)50)5-1-3-7-55-14-9-13(12-54)10-15(11-14)56-8-4-2-6-17(30,31)19(34,35)21(38,39)23(42,43)25(46,47)27(51,52)53/h9-11,54H,1-8,12H2 |
| InChIKey | ROGLBUQURYQARY-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.42 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|