C31H28F26O2 — CID 101393273
3,4-bis(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)benzoic acid (PubChem CID 101393273) has the molecular formula C31H28F26O2 and a molecular weight of 926.51 g/mol. Its IUPAC name is 3,4-bis(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)benzoic acid.
| Compound Name | 3,4-bis(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)benzoic acid |
|---|---|
| PubChem CID | 101393273 |
| Molecular Formula | C31H28F26O2 |
| Molecular Weight | 926.51 g/mol |
| Exact Mass | 926.17 |
| IUPAC Name | 3,4-bis(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(CCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C31H28F26O2/c32-20(33,22(36,37)24(40,41)26(44,45)28(48,49)30(52,53)54)13-7-3-1-5-9-16-11-12-18(19(58)59)15-17(16)10-6-2-4-8-14-21(34,35)23(38,39)25(42,43)27(46,47)29(50,51)31(55,56)57/h11-12,15H,1-10,13-14H2,(H,58,59) |
| InChIKey | CONMLHANRRAWSN-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.51 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|