C15H3F26IN2 — CID 141370471
1,3-bis(1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-2-yl)imidazol-1-ium iodide (PubChem CID 141370471) has the molecular formula C15H3F26IN2 and a molecular weight of 832.05 g/mol. Its IUPAC name is 1,3-bis(1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-2-yl)imidazol-1-ium iodide.
| Compound Name | 1,3-bis(1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-2-yl)imidazol-1-ium iodide |
|---|---|
| PubChem CID | 141370471 |
| Molecular Formula | C15H3F26IN2 |
| Molecular Weight | 832.05 g/mol |
| Exact Mass | 831.89 |
| IUPAC Name | 1,3-bis(1,1,1,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-2-yl)imidazol-1-ium iodide |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(n1cc[n+](C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1)C(F)(F)F.[I-] |
| InChI | InChI=1S/C15H3F26N2.HI/c16-4(17,8(24,25)12(30,31)32)6(20,21)10(28,14(36,37)38)42-1-2-43(3-42)11(29,15(39,40)41)7(22,23)5(18,19)9(26,27)13(33,34)35;/h1-3H;1H/q+1;/p-1 |
| InChIKey | BLNYIYIZJWYNCO-UHFFFAOYSA-M |
| XLogP | 5.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.05 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|