C9H4Cl2F10N2O — CID 87421571
1-[2-(3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutoxy)-1,1,2-trifluoroethyl]imidazole (PubChem CID 87421571) has the molecular formula C9H4Cl2F10N2O and a molecular weight of 417.03 g/mol. Its IUPAC name is 1-[2-(3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutoxy)-1,1,2-trifluoroethyl]imidazole.
| Compound Name | 1-[2-(3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutoxy)-1,1,2-trifluoroethyl]imidazole |
|---|---|
| PubChem CID | 87421571 |
| Molecular Formula | C9H4Cl2F10N2O |
| Molecular Weight | 417.03 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | 1-[2-(3,4-dichloro-1,1,2,2,3,4,4-heptafluorobutoxy)-1,1,2-trifluoroethyl]imidazole |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(Cl)C(F)(F)Cl)C(F)(F)n1ccnc1 |
| InChI | InChI=1S/C9H4Cl2F10N2O/c10-6(15,8(11,18)19)7(16,17)9(20,21)24-4(12)5(13,14)23-2-1-22-3-23/h1-4H |
| InChIKey | OZXAYWVLMVSAKS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|