C8H7BrF4N4 — CID 162234021
1-(2-bromo-1,1,2,2-tetrafluoroethyl)imidazole;1H-imidazole (PubChem CID 162234021) has the molecular formula C8H7BrF4N4 and a molecular weight of 315.07 g/mol. Its IUPAC name is 1-(2-bromo-1,1,2,2-tetrafluoroethyl)imidazole;1H-imidazole.
| Compound Name | 1-(2-bromo-1,1,2,2-tetrafluoroethyl)imidazole;1H-imidazole |
|---|---|
| PubChem CID | 162234021 |
| Molecular Formula | C8H7BrF4N4 |
| Molecular Weight | 315.07 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1-(2-bromo-1,1,2,2-tetrafluoroethyl)imidazole;1H-imidazole |
| SMILES | FC(F)(Br)C(F)(F)n1ccnc1.c1c[nH]cn1 |
| InChI | InChI=1S/C5H3BrF4N2.C3H4N2/c6-4(7,8)5(9,10)12-2-1-11-3-12;1-2-5-3-4-1/h1-3H;1-3H,(H,4,5) |
| InChIKey | ZVVAURHJHUXNNK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|