C15H16F14O4 — CID 142646958
2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-7-fluorooct-1-ene (PubChem CID 142646958) has the molecular formula C15H16F14O4 and a molecular weight of 526.26 g/mol. Its IUPAC name is 2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-7-fluorooct-1-ene.
| Compound Name | 2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-7-fluorooct-1-ene |
|---|---|
| PubChem CID | 142646958 |
| Molecular Formula | C15H16F14O4 |
| Molecular Weight | 526.26 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | 2-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]-7-fluorooct-1-ene |
| SMILES | C=C(CCCCC(C)F)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C15H16F14O4/c1-8(16)5-3-4-6-9(2)30-7-10(17,18)31-11(19,20)12(21,22)32-13(23,24)14(25,26)33-15(27,28)29/h8H,2-7H2,1H3 |
| InChIKey | PFJPOBZWDSGYRO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.26 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|