C22H24F12O11 — CID 176644616
4-O-[2-[2-[2-[1,1-difluoro-2-(4-oxobutanoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] 1-O-(6-oxohexyl) butanedioate (PubChem CID 176644616) has the molecular formula C22H24F12O11 and a molecular weight of 692.40 g/mol. Its IUPAC name is 4-O-[2-[2-[2-[1,1-difluoro-2-(4-oxobutanoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] 1-O-(6-oxohexyl) butanedioate.
| Compound Name | 4-O-[2-[2-[2-[1,1-difluoro-2-(4-oxobutanoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] 1-O-(6-oxohexyl) butanedioate |
|---|---|
| PubChem CID | 176644616 |
| Molecular Formula | C22H24F12O11 |
| Molecular Weight | 692.40 g/mol |
| Exact Mass | 692.11 |
| IUPAC Name | 4-O-[2-[2-[2-[1,1-difluoro-2-(4-oxobutanoyloxy)ethoxy]-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] 1-O-(6-oxohexyl) butanedioate |
| SMILES | O=CCCCCCOC(=O)CCC(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COC(=O)CCC=O |
| InChI | InChI=1S/C22H24F12O11/c23-17(24,12-41-14(37)6-5-10-36)43-19(27,28)21(31,32)45-22(33,34)20(29,30)44-18(25,26)13-42-16(39)8-7-15(38)40-11-4-2-1-3-9-35/h9-10H,1-8,11-13H2 |
| InChIKey | IOZWQGIQDYQWGQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|