About 5-oxopentyl pentanoate
5-oxopentyl pentanoate (PubChem CID 172587572) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 5-oxopentyl pentanoate.
Molecular Properties
| Compound Name | 5-oxopentyl pentanoate |
| PubChem CID | 172587572 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 5-oxopentyl pentanoate |
| SMILES | CCCCC(=O)OCCCCC=O |
| InChI | InChI=1S/C10H18O3/c1-2-3-7-10(12)13-9-6-4-5-8-11/h8H,2-7,9H2,1H3 |
| InChIKey | NCWTVBQXZXSZJF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-oxopentyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxopentyl pentanoate?
The IUPAC name of 5-oxopentyl pentanoate (CID 172587572) is 5-oxopentyl pentanoate.
What is the SMILES notation for 5-oxopentyl pentanoate?
The canonical SMILES for 5-oxopentyl pentanoate is CCCCC(=O)OCCCCC=O.
What is the InChIKey of 5-oxopentyl pentanoate?
The InChIKey is NCWTVBQXZXSZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-2-3-7-10(12)13-9-6-4-5-8-11/h8H,2-7,9H2,1H3.
What are the key properties of 5-oxopentyl pentanoate?
5-oxopentyl pentanoate has a molecular weight of 186.25 g/mol, XLogP of 2.09, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxopentyl pentanoate is sourced from PubChem (CID 172587572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).