C13H24O6 — CID 54054566
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 8-oxooctanoate (PubChem CID 54054566) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 8-oxooctanoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 8-oxooctanoate |
|---|---|
| PubChem CID | 54054566 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 8-oxooctanoate |
| SMILES | O=CCCCCCCC(=O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C13H24O6/c14-7-5-3-1-2-4-6-12(18)19-11-13(8-15,9-16)10-17/h7,15-17H,1-6,8-11H2 |
| InChIKey | LVIRCBHHRBYQIK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|