C44H80O7 — CID 54492995
[2-(hydroxymethyl)-2-(octadec-9-enoyloxymethyl)-3-propanoyloxypropyl] octadec-9-enoate (PubChem CID 54492995) has the molecular formula C44H80O7 and a molecular weight of 721.12 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-(octadec-9-enoyloxymethyl)-3-propanoyloxypropyl] octadec-9-enoate.
| Compound Name | [2-(hydroxymethyl)-2-(octadec-9-enoyloxymethyl)-3-propanoyloxypropyl] octadec-9-enoate |
|---|---|
| PubChem CID | 54492995 |
| Molecular Formula | C44H80O7 |
| Molecular Weight | 721.12 g/mol |
| Exact Mass | 720.59 |
| IUPAC Name | [2-(hydroxymethyl)-2-(octadec-9-enoyloxymethyl)-3-propanoyloxypropyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)(COC(=O)CC)COC(=O)CCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C44H80O7/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-42(47)50-39-44(37-45,38-49-41(46)6-3)40-51-43(48)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,45H,4-18,23-40H2,1-3H3 |
| InChIKey | XXCBKOQVAPUNPK-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.12 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|