C12H17F3O4 — CID 156693697
6-oxohexyl 5,5,5-trifluoro-4-hydroxy-2-methylidenepentanoate (PubChem CID 156693697) has the molecular formula C12H17F3O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 6-oxohexyl 5,5,5-trifluoro-4-hydroxy-2-methylidenepentanoate.
| Compound Name | 6-oxohexyl 5,5,5-trifluoro-4-hydroxy-2-methylidenepentanoate |
|---|---|
| PubChem CID | 156693697 |
| Molecular Formula | C12H17F3O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 6-oxohexyl 5,5,5-trifluoro-4-hydroxy-2-methylidenepentanoate |
| SMILES | C=C(CC(O)C(F)(F)F)C(=O)OCCCCCC=O |
| InChI | InChI=1S/C12H17F3O4/c1-9(8-10(17)12(13,14)15)11(18)19-7-5-3-2-4-6-16/h6,10,17H,1-5,7-8H2 |
| InChIKey | VNMPXOIMJRRVLV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|