About 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate
8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate (PubChem CID 165388741) has the molecular formula C28H50O5
and a molecular weight of 466.70 g/mol. Its IUPAC name is 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate.
Molecular Properties
| Compound Name | 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate |
| PubChem CID | 165388741 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate |
| SMILES | C=C(COCC(=C)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C28H50O5/c1-23(2)17-13-9-7-11-15-19-32-27(29)25(5)21-31-22-26(6)28(30)33-20-16-12-8-10-14-18-24(3)4/h23-24H,5-22H2,1-4H3 |
| InChIKey | CTXBXQCGOWBGAW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate?
The IUPAC name of 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate (CID 165388741) is 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate.
What is the SMILES notation for 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate?
The canonical SMILES for 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate is C=C(COCC(=C)C(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C.
What is the InChIKey of 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate?
The InChIKey is CTXBXQCGOWBGAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H50O5/c1-23(2)17-13-9-7-11-15-19-32-27(29)25(5)21-31-22-26(6)28(30)33-20-16-12-8-10-14-18-24(3)4/h23-24H,5-22H2,1-4H3.
What are the key properties of 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate?
8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate has a molecular weight of 466.70 g/mol, XLogP of 7.20, 22 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylnonyl 2-[2-(8-methylnonoxycarbonyl)prop-2-enoxymethyl]prop-2-enoate is sourced from PubChem (CID 165388741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).