C15H24O5 — CID 174792723
pentyl 4-hydroxy-2-methylidene-5-prop-2-enoyloxyhexanoate (PubChem CID 174792723) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is pentyl 4-hydroxy-2-methylidene-5-prop-2-enoyloxyhexanoate.
| Compound Name | pentyl 4-hydroxy-2-methylidene-5-prop-2-enoyloxyhexanoate |
|---|---|
| PubChem CID | 174792723 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | pentyl 4-hydroxy-2-methylidene-5-prop-2-enoyloxyhexanoate |
| SMILES | C=CC(=O)OC(C)C(O)CC(=C)C(=O)OCCCCC |
| InChI | InChI=1S/C15H24O5/c1-5-7-8-9-19-15(18)11(3)10-13(16)12(4)20-14(17)6-2/h6,12-13,16H,2-3,5,7-10H2,1,4H3 |
| InChIKey | UMNHHDLFSRLMMO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|