About 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate
6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate (PubChem CID 88981162) has the molecular formula C30H50O11
and a molecular weight of 586.72 g/mol. Its IUPAC name is 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate.
Molecular Properties
| Compound Name | 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate |
| PubChem CID | 88981162 |
| Molecular Formula | C30H50O11 |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate |
| SMILES | C=C(C)C(=O)OCCOOCCCCCC(=O)OCCCCCC(=O)OCCCCCC(=O)OCCCCCC=O |
| InChI | InChI=1S/C30H50O11/c1-26(2)30(35)39-24-25-41-40-23-15-7-10-18-29(34)38-22-14-6-9-17-28(33)37-21-13-5-8-16-27(32)36-20-12-4-3-11-19-31/h19H,1,3-18,20-25H2,2H3 |
| InChIKey | NZJWPWFYDVOMIQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate?
The IUPAC name of 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate (CID 88981162) is 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate.
What is the SMILES notation for 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate?
The canonical SMILES for 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate is C=C(C)C(=O)OCCOOCCCCCC(=O)OCCCCCC(=O)OCCCCCC(=O)OCCCCCC=O.
What is the InChIKey of 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate?
The InChIKey is NZJWPWFYDVOMIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H50O11/c1-26(2)30(35)39-24-25-41-40-23-15-7-10-18-29(34)38-22-14-6-9-17-28(33)37-21-13-5-8-16-27(32)36-20-12-4-3-11-19-31/h19H,1,3-18,20-25H2,2H3.
What are the key properties of 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate?
6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate has a molecular weight of 586.72 g/mol, XLogP of 5.12, 29 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxohexyl 6-[6-[6-[2-(2-methylprop-2-enoyloxy)ethylperoxy]hexanoyloxy]hexanoyloxy]hexanoate is sourced from PubChem (CID 88981162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).