C13H14BrF13O4 — CID 21225321
1-bromo-6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]hexane (PubChem CID 21225321) has the molecular formula C13H14BrF13O4 and a molecular weight of 561.13 g/mol. Its IUPAC name is 1-bromo-6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]hexane.
| Compound Name | 1-bromo-6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]hexane |
|---|---|
| PubChem CID | 21225321 |
| Molecular Formula | C13H14BrF13O4 |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | 1-bromo-6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethoxy]ethoxy]hexane |
| SMILES | FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COCCCCCCBr |
| InChI | InChI=1S/C13H14BrF13O4/c14-5-3-1-2-4-6-28-7-8(15,16)29-9(17,18)10(19,20)30-11(21,22)12(23,24)31-13(25,26)27/h1-7H2 |
| InChIKey | MEPWAHMTYBORGK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|